C20H24N2O2 — CID 21223288
1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid (PubChem CID 21223288) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid.
| Compound Name | 1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid |
|---|---|
| PubChem CID | 21223288 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylic acid |
| SMILES | O=C(O)C1CCCC2CN3CCc4c([nH]c5ccccc45)C3CC21 |
| InChI | InChI=1S/C20H24N2O2/c23-20(24)15-6-3-4-12-11-22-9-8-14-13-5-1-2-7-17(13)21-19(14)18(22)10-16(12)15/h1-2,5,7,12,15-16,18,21H,3-4,6,8-11H2,(H,23,24) |
| InChIKey | KCTIPWXZSOCWJB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|