C22H28N2OS2 — CID 11773979
O-ethyl [(1S,15S,19R,20S)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]sulfanylmethanethioate (PubChem CID 11773979) has the molecular formula C22H28N2OS2 and a molecular weight of 400.61 g/mol. Its IUPAC name is O-ethyl [(1S,15S,19R,20S)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [(1S,15S,19R,20S)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 11773979 |
| Molecular Formula | C22H28N2OS2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | O-ethyl [(1S,15S,19R,20S)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)S[C@@H]1CCC[C@@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C22H28N2OS2/c1-2-25-22(26)27-20-9-5-6-14-13-24-11-10-16-15-7-3-4-8-18(15)23-21(16)19(24)12-17(14)20/h3-4,7-8,14,17,19-20,23H,2,5-6,9-13H2,1H3/t14-,17+,19+,20-/m1/s1 |
| InChIKey | PGVFKXYYEJXWLF-PEFDPPPMSA-N |
| XLogP | 5.31 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|