C21H28N2O2 — CID 95560164
[(1S,15S,18R,19R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]methanol (PubChem CID 95560164) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [(1S,15S,18R,19R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]methanol.
| Compound Name | [(1S,15S,18R,19R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]methanol |
|---|---|
| PubChem CID | 95560164 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [(1S,15S,18R,19R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]methanol |
| SMILES | CO[C@@H]1CC[C@@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@@H]2[C@@H]1CO |
| InChI | InChI=1S/C21H28N2O2/c1-25-20-7-6-13-11-23-9-8-15-14-4-2-3-5-18(14)22-21(15)19(23)10-16(13)17(20)12-24/h2-5,13,16-17,19-20,22,24H,6-12H2,1H3/t13-,16+,17+,19+,20-/m1/s1 |
| InChIKey | NWVMGSHVNNFQRI-OCSHYGNBSA-N |
| XLogP | 3.12 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|