C28H42N2O2 — CID 144736837
hexane;1-[(1S,15R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]ethanone (PubChem CID 144736837) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is hexane;1-[(1S,15R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]ethanone.
| Compound Name | hexane;1-[(1S,15R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]ethanone |
|---|---|
| PubChem CID | 144736837 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | hexane;1-[(1S,15R,20S)-18-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-yl]ethanone |
| SMILES | CCCCCC.COC1CC[C@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@@H]2C1C(C)=O |
| InChI | InChI=1S/C22H28N2O2.C6H14/c1-13(25)21-17-11-19-22-16(15-5-3-4-6-18(15)23-22)9-10-24(19)12-14(17)7-8-20(21)26-2;1-3-5-6-4-2/h3-6,14,17,19-21,23H,7-12H2,1-2H3;3-6H2,1-2H3/t14-,17-,19-,20?,21?;/m0./s1 |
| InChIKey | SONZAHKRIAHVQW-FUYROBPOSA-N |
| XLogP | 6.30 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|