C27H34N4O2 — CID 25141782
(1S,15R,18S,20S)-18-hydroxy-N-(3-pyrrol-1-ylpropyl)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide (PubChem CID 25141782) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (1S,15R,18S,20S)-18-hydroxy-N-(3-pyrrol-1-ylpropyl)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide.
| Compound Name | (1S,15R,18S,20S)-18-hydroxy-N-(3-pyrrol-1-ylpropyl)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide |
|---|---|
| PubChem CID | 25141782 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (1S,15R,18S,20S)-18-hydroxy-N-(3-pyrrol-1-ylpropyl)-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide |
| SMILES | O=C(NCCCn1cccc1)C1[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3C[C@@H]2CC[C@@H]1O |
| InChI | InChI=1S/C27H34N4O2/c32-24-9-8-18-17-31-15-10-20-19-6-1-2-7-22(19)29-26(20)23(31)16-21(18)25(24)27(33)28-11-5-14-30-12-3-4-13-30/h1-4,6-7,12-13,18,21,23-25,29,32H,5,8-11,14-17H2,(H,28,33)/t18-,21-,23-,24-,25?/m0/s1 |
| InChIKey | IECGHNOORFXHJZ-SECGUCFFSA-N |
| XLogP | 3.48 |
| TPSA | 73.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|