C33H39N5O4 — CID 25141904
(1S,15R,18S,20S)-N-[3-(3-benzyl-2,5-dioxoimidazolidin-1-yl)propyl]-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide (PubChem CID 25141904) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is (1S,15R,18S,20S)-N-[3-(3-benzyl-2,5-dioxoimidazolidin-1-yl)propyl]-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide.
| Compound Name | (1S,15R,18S,20S)-N-[3-(3-benzyl-2,5-dioxoimidazolidin-1-yl)propyl]-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide |
|---|---|
| PubChem CID | 25141904 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | (1S,15R,18S,20S)-N-[3-(3-benzyl-2,5-dioxoimidazolidin-1-yl)propyl]-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxamide |
| SMILES | O=C(NCCCN1C(=O)CN(Cc2ccccc2)C1=O)C1[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3C[C@@H]2CC[C@@H]1O |
| InChI | InChI=1S/C33H39N5O4/c39-28-12-11-22-19-36-16-13-24-23-9-4-5-10-26(23)35-31(24)27(36)17-25(22)30(28)32(41)34-14-6-15-38-29(40)20-37(33(38)42)18-21-7-2-1-3-8-21/h1-5,7-10,22,25,27-28,30,35,39H,6,11-20H2,(H,34,41)/t22-,25-,27-,28-,30?/m0/s1 |
| InChIKey | JWWMYVZKMRUQCP-LBSQRKHVSA-N |
| XLogP | 3.44 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|