C19H22N2O — CID 10125500
(1R,16S,21R)-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8-tetraen-20-one (PubChem CID 10125500) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (1R,16S,21R)-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8-tetraen-20-one.
| Compound Name | (1R,16S,21R)-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8-tetraen-20-one |
|---|---|
| PubChem CID | 10125500 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (1R,16S,21R)-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8-tetraen-20-one |
| SMILES | O=C1CCC[C@H]2CCN3CCc4c([nH]c5ccccc45)[C@H]3[C@H]12 |
| InChI | InChI=1S/C19H22N2O/c22-16-7-3-4-12-8-10-21-11-9-14-13-5-1-2-6-15(13)20-18(14)19(21)17(12)16/h1-2,5-6,12,17,19-20H,3-4,7-11H2/t12-,17-,19+/m0/s1 |
| InChIKey | FYSWWRMZODICAG-OYYNGEPBSA-N |
| XLogP | 3.46 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|