C16H19N — CID 91153684
1-cyclobutyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 91153684) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-cyclobutyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 1-cyclobutyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 91153684 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-cyclobutyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | c1ccc2c3c([nH]c2c1)C(C1CCC1)CCC3 |
| InChI | InChI=1S/C16H19N/c1-2-10-15-13(7-1)14-9-4-8-12(16(14)17-15)11-5-3-6-11/h1-2,7,10-12,17H,3-6,8-9H2 |
| InChIKey | ZWKAMJIIUYKMKU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |