C18H17ClN2 — CID 65333996
N-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65333996) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65333996 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-(2-chlorophenyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | Clc1ccccc1NC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C18H17ClN2/c19-14-8-2-4-10-16(14)20-17-11-5-7-13-12-6-1-3-9-15(12)21-18(13)17/h1-4,6,8-10,17,20-21H,5,7,11H2 |
| InChIKey | DSCHWDVXXNCJTA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|