C19H22N2O — CID 73233018
1-(1-ethylidene-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-2-yl)ethanone (PubChem CID 73233018) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-(1-ethylidene-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-2-yl)ethanone.
| Compound Name | 1-(1-ethylidene-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-2-yl)ethanone |
|---|---|
| PubChem CID | 73233018 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-(1-ethylidene-3,4,6,7,12,12b-hexahydro-2H-indolo[2,3-a]quinolizin-2-yl)ethanone |
| SMILES | CC=C1C(C(C)=O)CCN2CCc3c([nH]c4ccccc34)C12 |
| InChI | InChI=1S/C19H22N2O/c1-3-13-14(12(2)22)8-10-21-11-9-16-15-6-4-5-7-17(15)20-18(16)19(13)21/h3-7,14,19-20H,8-11H2,1-2H3 |
| InChIKey | VJQGSWILQPMNPT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|