C22H22N2O2 — CID 163638999
1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl benzoate (PubChem CID 163638999) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl benzoate.
| Compound Name | 1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl benzoate |
|---|---|
| PubChem CID | 163638999 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl benzoate |
| SMILES | O=C(OC1CCN2CCc3c([nH]c4ccccc34)C2C1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c25-22(15-6-2-1-3-7-15)26-16-10-12-24-13-11-18-17-8-4-5-9-19(17)23-21(18)20(24)14-16/h1-9,16,20,23H,10-14H2 |
| InChIKey | ICPASBVOMZADSW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|