C18H26N4O2S — CID 54046403
N-[2-[[(2S,12bR)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]amino]ethyl]methanesulfonamide (PubChem CID 54046403) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[2-[[(2S,12bR)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[(2S,12bR)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 54046403 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[2-[[(2S,12bR)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN[C@H]1CCN2CCc3c([nH]c4ccccc34)[C@H]2C1 |
| InChI | InChI=1S/C18H26N4O2S/c1-25(23,24)20-9-8-19-13-6-10-22-11-7-15-14-4-2-3-5-16(14)21-18(15)17(22)12-13/h2-5,13,17,19-21H,6-12H2,1H3/t13-,17+/m0/s1 |
| InChIKey | LPWSHLTWRQPKLY-SUMWQHHRSA-N |
| XLogP | 1.37 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|