C22H25N3 — CID 90675248
(12bS)-N-benzyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-amine (PubChem CID 90675248) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (12bS)-N-benzyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-amine.
| Compound Name | (12bS)-N-benzyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-amine |
|---|---|
| PubChem CID | 90675248 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (12bS)-N-benzyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-amine |
| SMILES | c1ccc(CNC2CCN3CCc4c([nH]c5ccccc45)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C22H25N3/c1-2-6-16(7-3-1)15-23-17-10-12-25-13-11-19-18-8-4-5-9-20(18)24-22(19)21(25)14-17/h1-9,17,21,23-24H,10-15H2/t17?,21-/m0/s1 |
| InChIKey | KFJZWPDOOOXOSJ-LFABVHOISA-N |
| XLogP | 4.02 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|