C37H49N3O5 — CID 157263037
cyclopentyl (2S)-2-[[2-(9-ethoxy-8-oxononanoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl-methylamino]-2-phenylacetate (PubChem CID 157263037) has the molecular formula C37H49N3O5 and a molecular weight of 615.82 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[2-(9-ethoxy-8-oxononanoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl-methylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[[2-(9-ethoxy-8-oxononanoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl-methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 157263037 |
| Molecular Formula | C37H49N3O5 |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.37 |
| IUPAC Name | cyclopentyl (2S)-2-[[2-(9-ethoxy-8-oxononanoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl-methylamino]-2-phenylacetate |
| SMILES | CCOCC(=O)CCCCCCC(=O)N1CCc2c([nH]c3ccccc23)C1CN(C)[C@H](C(=O)OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C37H49N3O5/c1-3-44-26-28(41)17-9-4-5-10-22-34(42)40-24-23-31-30-20-13-14-21-32(30)38-35(31)33(40)25-39(2)36(27-15-7-6-8-16-27)37(43)45-29-18-11-12-19-29/h6-8,13-16,20-21,29,33,36,38H,3-5,9-12,17-19,22-26H2,1-2H3/t33?,36-/m0/s1 |
| InChIKey | AXRKSAWFZPCQFZ-CRGCAJGSSA-N |
| XLogP | 6.70 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|