C32H44N2O5 — CID 123258920
cyclopentyl (2S)-2-[[2-[(9-ethoxy-8-oxononanoyl)amino]phenyl]methyl-methylamino]-2-phenylacetate (PubChem CID 123258920) has the molecular formula C32H44N2O5 and a molecular weight of 536.71 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[2-[(9-ethoxy-8-oxononanoyl)amino]phenyl]methyl-methylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[[2-[(9-ethoxy-8-oxononanoyl)amino]phenyl]methyl-methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 123258920 |
| Molecular Formula | C32H44N2O5 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | cyclopentyl (2S)-2-[[2-[(9-ethoxy-8-oxononanoyl)amino]phenyl]methyl-methylamino]-2-phenylacetate |
| SMILES | CCOCC(=O)CCCCCCC(=O)Nc1ccccc1CN(C)[C@H](C(=O)OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C32H44N2O5/c1-3-38-24-27(35)18-9-4-5-10-22-30(36)33-29-21-14-11-17-26(29)23-34(2)31(25-15-7-6-8-16-25)32(37)39-28-19-12-13-20-28/h6-8,11,14-17,21,28,31H,3-5,9-10,12-13,18-20,22-24H2,1-2H3,(H,33,36)/t31-/m0/s1 |
| InChIKey | RHXNEKONDXBRQY-HKBQPEDESA-N |
| XLogP | 6.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|