C26H35N3O2 — CID 97088995
N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-N'-[(1R)-1-phenylethyl]butanediamide (PubChem CID 97088995) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-N'-[(1R)-1-phenylethyl]butanediamide.
| Compound Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-N'-[(1R)-1-phenylethyl]butanediamide |
|---|---|
| PubChem CID | 97088995 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-N'-[(1R)-1-phenylethyl]butanediamide |
| SMILES | C[C@@H](NC(=O)CCC(=O)Nc1ccccc1CN(C)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H35N3O2/c1-20(21-11-5-3-6-12-21)27-25(30)17-18-26(31)28-24-16-10-9-13-22(24)19-29(2)23-14-7-4-8-15-23/h3,5-6,9-13,16,20,23H,4,7-8,14-15,17-19H2,1-2H3,(H,27,30)(H,28,31)/t20-/m1/s1 |
| InChIKey | SVJDLEXKCPXNRJ-HXUWFJFHSA-N |
| XLogP | 5.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |