C23H39Cl2N3O — CID 119828880
N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119828880) has the molecular formula C23H39Cl2N3O and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119828880 |
| Molecular Formula | C23H39Cl2N3O |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)Nc1ccccc1CN(C)C1CCCCC1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C23H37N3O.2ClH/c1-18(19-10-8-14-24-16-19)15-23(27)25-22-13-7-6-9-20(22)17-26(2)21-11-4-3-5-12-21;;/h6-7,9,13,18-19,21,24H,3-5,8,10-12,14-17H2,1-2H3,(H,25,27);2*1H |
| InChIKey | QNZZQGQPKBVAGG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |