C16H26ClN3O3S — CID 119704022
N-[2-(methanesulfonamido)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119704022) has the molecular formula C16H26ClN3O3S and a molecular weight of 375.92 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-[2-(methanesulfonamido)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119704022 |
| Molecular Formula | C16H26ClN3O3S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[2-(methanesulfonamido)phenyl]-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccccc1NS(C)(=O)=O)C1CCCNC1.Cl |
| InChI | InChI=1S/C16H25N3O3S.ClH/c1-12(13-6-5-9-17-11-13)10-16(20)18-14-7-3-4-8-15(14)19-23(2,21)22;/h3-4,7-8,12-13,17,19H,5-6,9-11H2,1-2H3,(H,18,20);1H |
| InChIKey | MIBMUMMCKPGASW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |