C20H33N3O3S — CID 119798926
N-[3-(tert-butylsulfamoyl)-2-methylphenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119798926) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is N-[3-(tert-butylsulfamoyl)-2-methylphenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[3-(tert-butylsulfamoyl)-2-methylphenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119798926 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[3-(tert-butylsulfamoyl)-2-methylphenyl]-3-piperidin-3-ylbutanamide |
| SMILES | Cc1c(NC(=O)CC(C)C2CCCNC2)cccc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H33N3O3S/c1-14(16-8-7-11-21-13-16)12-19(24)22-17-9-6-10-18(15(17)2)27(25,26)23-20(3,4)5/h6,9-10,14,16,21,23H,7-8,11-13H2,1-5H3,(H,22,24) |
| InChIKey | RZACZCGFVGKSGF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |