C21H31N3O3 — CID 119750611
N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]-3-piperidin-3-ylbutanamide (PubChem CID 119750611) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119750611 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | N-[2-methyl-3-(morpholine-4-carbonyl)phenyl]-3-piperidin-3-ylbutanamide |
| SMILES | Cc1c(NC(=O)CC(C)C2CCCNC2)cccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H31N3O3/c1-15(17-5-4-8-22-14-17)13-20(25)23-19-7-3-6-18(16(19)2)21(26)24-9-11-27-12-10-24/h3,6-7,15,17,22H,4-5,8-14H2,1-2H3,(H,23,25) |
| InChIKey | NRIZNLJNOGMCBH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |