C23H35N3O2 — CID 119741220
N-cyclohexyl-N-methyl-2-(3-piperidin-3-ylbutanoylamino)benzamide (PubChem CID 119741220) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-(3-piperidin-3-ylbutanoylamino)benzamide.
| Compound Name | N-cyclohexyl-N-methyl-2-(3-piperidin-3-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 119741220 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-(3-piperidin-3-ylbutanoylamino)benzamide |
| SMILES | CC(CC(=O)Nc1ccccc1C(=O)N(C)C1CCCCC1)C1CCCNC1 |
| InChI | InChI=1S/C23H35N3O2/c1-17(18-9-8-14-24-16-18)15-22(27)25-21-13-7-6-12-20(21)23(28)26(2)19-10-4-3-5-11-19/h6-7,12-13,17-19,24H,3-5,8-11,14-16H2,1-2H3,(H,25,27) |
| InChIKey | WPDABJQLXRBZJP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |