C28H34N2O6 — CID 161086489
cyclopentyl (2S)-2-[[3-(5-ethoxy-2,4-dioxopentyl)phenyl]methylcarbamoylamino]-2-phenylacetate (PubChem CID 161086489) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[3-(5-ethoxy-2,4-dioxopentyl)phenyl]methylcarbamoylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[[3-(5-ethoxy-2,4-dioxopentyl)phenyl]methylcarbamoylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 161086489 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | cyclopentyl (2S)-2-[[3-(5-ethoxy-2,4-dioxopentyl)phenyl]methylcarbamoylamino]-2-phenylacetate |
| SMILES | CCOCC(=O)CC(=O)Cc1cccc(CNC(=O)N[C@H](C(=O)OC2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H34N2O6/c1-2-35-19-24(32)17-23(31)16-20-9-8-10-21(15-20)18-29-28(34)30-26(22-11-4-3-5-12-22)27(33)36-25-13-6-7-14-25/h3-5,8-12,15,25-26H,2,6-7,13-14,16-19H2,1H3,(H2,29,30,34)/t26-/m0/s1 |
| InChIKey | UGOVFEMCGKGRMG-SANMLTNESA-N |
| XLogP | 3.82 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|