C32H42N2O7 — CID 148823494
cyclopentyl (2S)-2-[4-[3-[9-(hydroxyamino)-2,9-dioxononyl]phenoxy]butanoylamino]-2-phenylacetate (PubChem CID 148823494) has the molecular formula C32H42N2O7 and a molecular weight of 566.70 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[4-[3-[9-(hydroxyamino)-2,9-dioxononyl]phenoxy]butanoylamino]-2-phenylacetate.
| Compound Name | cyclopentyl (2S)-2-[4-[3-[9-(hydroxyamino)-2,9-dioxononyl]phenoxy]butanoylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 148823494 |
| Molecular Formula | C32H42N2O7 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | cyclopentyl (2S)-2-[4-[3-[9-(hydroxyamino)-2,9-dioxononyl]phenoxy]butanoylamino]-2-phenylacetate |
| SMILES | O=C(CCCCCCC(=O)NO)Cc1cccc(OCCCC(=O)N[C@H](C(=O)OC2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H42N2O7/c35-26(15-6-1-2-7-19-30(37)34-39)22-24-12-10-18-28(23-24)40-21-11-20-29(36)33-31(25-13-4-3-5-14-25)32(38)41-27-16-8-9-17-27/h3-5,10,12-14,18,23,27,31,39H,1-2,6-9,11,15-17,19-22H2,(H,33,36)(H,34,37)/t31-/m0/s1 |
| InChIKey | OSGBMEDVPYNFPF-HKBQPEDESA-N |
| XLogP | 5.15 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|