C28H37N3O7 — CID 90211862
methyl (2S)-2-[4-[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenoxy]butanoylamino]-3-phenylpropanoate (PubChem CID 90211862) has the molecular formula C28H37N3O7 and a molecular weight of 527.62 g/mol. Its IUPAC name is methyl (2S)-2-[4-[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenoxy]butanoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[4-[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenoxy]butanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 90211862 |
| Molecular Formula | C28H37N3O7 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | methyl (2S)-2-[4-[3-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenoxy]butanoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)CCCOc1cccc(NC(=O)CCCCCCC(=O)NO)c1 |
| InChI | InChI=1S/C28H37N3O7/c1-37-28(35)24(19-21-11-5-4-6-12-21)30-26(33)17-10-18-38-23-14-9-13-22(20-23)29-25(32)15-7-2-3-8-16-27(34)31-36/h4-6,9,11-14,20,24,36H,2-3,7-8,10,15-19H2,1H3,(H,29,32)(H,30,33)(H,31,34)/t24-/m0/s1 |
| InChIKey | BKUIZEKCRBENDN-DEOSSOPVSA-N |
| XLogP | 3.53 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|