C28H30N2O5 — CID 41263642
methyl (2S)-2-[[5-oxo-5-(4-phenylmethoxyanilino)pentanoyl]amino]-3-phenylpropanoate (PubChem CID 41263642) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is methyl (2S)-2-[[5-oxo-5-(4-phenylmethoxyanilino)pentanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[5-oxo-5-(4-phenylmethoxyanilino)pentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 41263642 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | methyl (2S)-2-[[5-oxo-5-(4-phenylmethoxyanilino)pentanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)CCCC(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2O5/c1-34-28(33)25(19-21-9-4-2-5-10-21)30-27(32)14-8-13-26(31)29-23-15-17-24(18-16-23)35-20-22-11-6-3-7-12-22/h2-7,9-12,15-18,25H,8,13-14,19-20H2,1H3,(H,29,31)(H,30,32)/t25-/m0/s1 |
| InChIKey | WCDVZAXDIICFKB-VWLOTQADSA-N |
| XLogP | 4.27 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |