C33H44N2O7 — CID 147763764
cyclopentyl (2S)-2-[[3-[9-(ethoxyamino)-2,9-dioxononyl]phenyl]methoxycarbonylamino]-3-phenylpropanoate (PubChem CID 147763764) has the molecular formula C33H44N2O7 and a molecular weight of 580.72 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[3-[9-(ethoxyamino)-2,9-dioxononyl]phenyl]methoxycarbonylamino]-3-phenylpropanoate.
| Compound Name | cyclopentyl (2S)-2-[[3-[9-(ethoxyamino)-2,9-dioxononyl]phenyl]methoxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 147763764 |
| Molecular Formula | C33H44N2O7 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | cyclopentyl (2S)-2-[[3-[9-(ethoxyamino)-2,9-dioxononyl]phenyl]methoxycarbonylamino]-3-phenylpropanoate |
| SMILES | CCONC(=O)CCCCCCC(=O)Cc1cccc(COC(=O)N[C@@H](Cc2ccccc2)C(=O)OC2CCCC2)c1 |
| InChI | InChI=1S/C33H44N2O7/c1-2-41-35-31(37)20-9-4-3-8-17-28(36)22-26-15-12-16-27(21-26)24-40-33(39)34-30(23-25-13-6-5-7-14-25)32(38)42-29-18-10-11-19-29/h5-7,12-16,21,29-30H,2-4,8-11,17-20,22-24H2,1H3,(H,34,39)(H,35,37)/t30-/m0/s1 |
| InChIKey | HEPABMRWTCFLCK-PMERELPUSA-N |
| XLogP | 5.53 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|