C22H26N2O4 — CID 67052665
cyclopentyl 2-[(3-aminophenyl)methoxycarbonylamino]-3-phenylpropanoate (PubChem CID 67052665) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is cyclopentyl 2-[(3-aminophenyl)methoxycarbonylamino]-3-phenylpropanoate.
| Compound Name | cyclopentyl 2-[(3-aminophenyl)methoxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67052665 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | cyclopentyl 2-[(3-aminophenyl)methoxycarbonylamino]-3-phenylpropanoate |
| SMILES | Nc1cccc(COC(=O)NC(Cc2ccccc2)C(=O)OC2CCCC2)c1 |
| InChI | InChI=1S/C22H26N2O4/c23-18-10-6-9-17(13-18)15-27-22(26)24-20(14-16-7-2-1-3-8-16)21(25)28-19-11-4-5-12-19/h1-3,6-10,13,19-20H,4-5,11-12,14-15,23H2,(H,24,26) |
| InChIKey | OQMWDIAVOYMJBA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|