C18H19BrN2O3 — CID 51308711
N-(2-amino-2-oxo-1-phenylethyl)-4-(3-bromophenoxy)butanamide (PubChem CID 51308711) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-4-(3-bromophenoxy)butanamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-4-(3-bromophenoxy)butanamide |
|---|---|
| PubChem CID | 51308711 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-4-(3-bromophenoxy)butanamide |
| SMILES | NC(=O)C(NC(=O)CCCOc1cccc(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C18H19BrN2O3/c19-14-8-4-9-15(12-14)24-11-5-10-16(22)21-17(18(20)23)13-6-2-1-3-7-13/h1-4,6-9,12,17H,5,10-11H2,(H2,20,23)(H,21,22) |
| InChIKey | DGHACXRJDLTAFL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|