C15H17BrN2O3 — CID 97057354
(2S)-2-[4-(3-bromophenoxy)butanoylamino]pent-4-ynamide (PubChem CID 97057354) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is (2S)-2-[4-(3-bromophenoxy)butanoylamino]pent-4-ynamide.
| Compound Name | (2S)-2-[4-(3-bromophenoxy)butanoylamino]pent-4-ynamide |
|---|---|
| PubChem CID | 97057354 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (2S)-2-[4-(3-bromophenoxy)butanoylamino]pent-4-ynamide |
| SMILES | C#CC[C@H](NC(=O)CCCOc1cccc(Br)c1)C(N)=O |
| InChI | InChI=1S/C15H17BrN2O3/c1-2-5-13(15(17)20)18-14(19)8-4-9-21-12-7-3-6-11(16)10-12/h1,3,6-7,10,13H,4-5,8-9H2,(H2,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | XZWKCAAHJIIIOV-ZDUSSCGKSA-N |
| XLogP | 1.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|