C13H14BrNO6 — CID 78910189
2-[3-(3-bromophenoxy)propanoylamino]butanedioic acid (PubChem CID 78910189) has the molecular formula C13H14BrNO6 and a molecular weight of 360.16 g/mol. Its IUPAC name is 2-[3-(3-bromophenoxy)propanoylamino]butanedioic acid.
| Compound Name | 2-[3-(3-bromophenoxy)propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 78910189 |
| Molecular Formula | C13H14BrNO6 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 2-[3-(3-bromophenoxy)propanoylamino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)CCOc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C13H14BrNO6/c14-8-2-1-3-9(6-8)21-5-4-11(16)15-10(13(19)20)7-12(17)18/h1-3,6,10H,4-5,7H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | DRTCZJRXZGICOP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |