C12H14BrNO5 — CID 61243301
2-[[2-(3-bromophenoxy)acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 61243301) has the molecular formula C12H14BrNO5 and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-[[2-(3-bromophenoxy)acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[2-(3-bromophenoxy)acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61243301 |
| Molecular Formula | C12H14BrNO5 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2-[[2-(3-bromophenoxy)acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(COc1cccc(Br)c1)NC(CCO)C(=O)O |
| InChI | InChI=1S/C12H14BrNO5/c13-8-2-1-3-9(6-8)19-7-11(16)14-10(4-5-15)12(17)18/h1-3,6,10,15H,4-5,7H2,(H,14,16)(H,17,18) |
| InChIKey | MTKJHVNKZQYFKZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |