C10H9BrCl3NO3 — CID 42280281
2-(3-bromophenoxy)-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]acetamide (PubChem CID 42280281) has the molecular formula C10H9BrCl3NO3 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]acetamide.
| Compound Name | 2-(3-bromophenoxy)-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]acetamide |
|---|---|
| PubChem CID | 42280281 |
| Molecular Formula | C10H9BrCl3NO3 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 374.88 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]acetamide |
| SMILES | O=C(COc1cccc(Br)c1)N[C@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9BrCl3NO3/c11-6-2-1-3-7(4-6)18-5-8(16)15-9(17)10(12,13)14/h1-4,9,17H,5H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | YHFMCHDGGUQNDO-SECBINFHSA-N |
| XLogP | 2.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|