C13H16BrNO4 — CID 3530351
2-[[2-(3-bromophenoxy)acetyl]amino]-3-methylbutanoic acid (PubChem CID 3530351) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is 2-[[2-(3-bromophenoxy)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-(3-bromophenoxy)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 3530351 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[[2-(3-bromophenoxy)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)COc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C13H16BrNO4/c1-8(2)12(13(17)18)15-11(16)7-19-10-5-3-4-9(14)6-10/h3-6,8,12H,7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | DMLTZDZSTIQYOF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |