C18H16BrFN2O2 — CID 56514887
4-(3-bromophenoxy)-N-[cyano-(2-fluorophenyl)methyl]butanamide (PubChem CID 56514887) has the molecular formula C18H16BrFN2O2 and a molecular weight of 391.24 g/mol. Its IUPAC name is 4-(3-bromophenoxy)-N-[cyano-(2-fluorophenyl)methyl]butanamide.
| Compound Name | 4-(3-bromophenoxy)-N-[cyano-(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 56514887 |
| Molecular Formula | C18H16BrFN2O2 |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 4-(3-bromophenoxy)-N-[cyano-(2-fluorophenyl)methyl]butanamide |
| SMILES | N#CC(NC(=O)CCCOc1cccc(Br)c1)c1ccccc1F |
| InChI | InChI=1S/C18H16BrFN2O2/c19-13-5-3-6-14(11-13)24-10-4-9-18(23)22-17(12-21)15-7-1-2-8-16(15)20/h1-3,5-8,11,17H,4,9-10H2,(H,22,23) |
| InChIKey | CEXPATVFFWCHFB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|