C16H13BrF3NO2 — CID 7958724
4-(3-bromophenoxy)-N-(2,3,4-trifluorophenyl)butanamide (PubChem CID 7958724) has the molecular formula C16H13BrF3NO2 and a molecular weight of 388.18 g/mol. Its IUPAC name is 4-(3-bromophenoxy)-N-(2,3,4-trifluorophenyl)butanamide.
| Compound Name | 4-(3-bromophenoxy)-N-(2,3,4-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 7958724 |
| Molecular Formula | C16H13BrF3NO2 |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 4-(3-bromophenoxy)-N-(2,3,4-trifluorophenyl)butanamide |
| SMILES | O=C(CCCOc1cccc(Br)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H13BrF3NO2/c17-10-3-1-4-11(9-10)23-8-2-5-14(22)21-13-7-6-12(18)15(19)16(13)20/h1,3-4,6-7,9H,2,5,8H2,(H,21,22) |
| InChIKey | WGSJTADSKLKOLW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|