C18H17BrClNO4 — CID 31525526
methyl 3-[4-(3-bromophenoxy)butanoylamino]-4-chlorobenzoate (PubChem CID 31525526) has the molecular formula C18H17BrClNO4 and a molecular weight of 426.69 g/mol. Its IUPAC name is methyl 3-[4-(3-bromophenoxy)butanoylamino]-4-chlorobenzoate.
| Compound Name | methyl 3-[4-(3-bromophenoxy)butanoylamino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 31525526 |
| Molecular Formula | C18H17BrClNO4 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | methyl 3-[4-(3-bromophenoxy)butanoylamino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CCCOc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C18H17BrClNO4/c1-24-18(23)12-7-8-15(20)16(10-12)21-17(22)6-3-9-25-14-5-2-4-13(19)11-14/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,21,22) |
| InChIKey | JRJKHOSFRDYJQX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|