C15H21ClN2O3 — CID 60849231
methyl 4-chloro-3-[4-(propan-2-ylamino)butanoylamino]benzoate (PubChem CID 60849231) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is methyl 4-chloro-3-[4-(propan-2-ylamino)butanoylamino]benzoate.
| Compound Name | methyl 4-chloro-3-[4-(propan-2-ylamino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 60849231 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 4-chloro-3-[4-(propan-2-ylamino)butanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CCCNC(C)C)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-10(2)17-8-4-5-14(19)18-13-9-11(15(20)21-3)6-7-12(13)16/h6-7,9-10,17H,4-5,8H2,1-3H3,(H,18,19) |
| InChIKey | FBNYODRSXNUACT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|