C22H25ClN2O4 — CID 18281701
methyl 3-[3-[(4-tert-butylbenzoyl)amino]propanoylamino]-4-chlorobenzoate (PubChem CID 18281701) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is methyl 3-[3-[(4-tert-butylbenzoyl)amino]propanoylamino]-4-chlorobenzoate.
| Compound Name | methyl 3-[3-[(4-tert-butylbenzoyl)amino]propanoylamino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 18281701 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | methyl 3-[3-[(4-tert-butylbenzoyl)amino]propanoylamino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CCNC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C22H25ClN2O4/c1-22(2,3)16-8-5-14(6-9-16)20(27)24-12-11-19(26)25-18-13-15(21(28)29-4)7-10-17(18)23/h5-10,13H,11-12H2,1-4H3,(H,24,27)(H,25,26) |
| InChIKey | RNFGYXNDQBJACO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |