C14H17FN2O2 — CID 95617367
N-[(S)-cyano-(2-fluorophenyl)methyl]-3-propan-2-yloxypropanamide (PubChem CID 95617367) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is N-[(S)-cyano-(2-fluorophenyl)methyl]-3-propan-2-yloxypropanamide.
| Compound Name | N-[(S)-cyano-(2-fluorophenyl)methyl]-3-propan-2-yloxypropanamide |
|---|---|
| PubChem CID | 95617367 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-[(S)-cyano-(2-fluorophenyl)methyl]-3-propan-2-yloxypropanamide |
| SMILES | CC(C)OCCC(=O)N[C@H](C#N)c1ccccc1F |
| InChI | InChI=1S/C14H17FN2O2/c1-10(2)19-8-7-14(18)17-13(9-16)11-5-3-4-6-12(11)15/h3-6,10,13H,7-8H2,1-2H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | CSUZEFZODFOJHK-CYBMUJFWSA-N |
| XLogP | 2.32 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |