C14H19BrN2O2 — CID 95304362
N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 95304362) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 95304362 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N[C@@H](C(N)=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-14(2,3)8-11(18)17-12(13(16)19)9-5-4-6-10(15)7-9/h4-7,12H,8H2,1-3H3,(H2,16,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | VMLRHGARGQKLHL-GFCCVEGCSA-N |
| XLogP | 2.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |