C13H11BrN2O2S — CID 94829119
N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 94829119) has the molecular formula C13H11BrN2O2S and a molecular weight of 339.21 g/mol. Its IUPAC name is N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 94829119 |
| Molecular Formula | C13H11BrN2O2S |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | N-[(1R)-2-amino-1-(3-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | NC(=O)[C@H](NC(=O)c1cccs1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H11BrN2O2S/c14-9-4-1-3-8(7-9)11(12(15)17)16-13(18)10-5-2-6-19-10/h1-7,11H,(H2,15,17)(H,16,18)/t11-/m1/s1 |
| InChIKey | YIHYAXGUYFYIDZ-LLVKDONJSA-N |
| XLogP | 2.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |