C14H10BrCl2N3O2 — CID 71882048
N-[2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,6-dichloropyridine-2-carboxamide (PubChem CID 71882048) has the molecular formula C14H10BrCl2N3O2 and a molecular weight of 403.06 g/mol. Its IUPAC name is N-[2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,6-dichloropyridine-2-carboxamide.
| Compound Name | N-[2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,6-dichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 71882048 |
| Molecular Formula | C14H10BrCl2N3O2 |
| Molecular Weight | 403.06 g/mol |
| Exact Mass | 400.93 |
| IUPAC Name | N-[2-amino-1-(3-bromophenyl)-2-oxoethyl]-3,6-dichloropyridine-2-carboxamide |
| SMILES | NC(=O)C(NC(=O)c1nc(Cl)ccc1Cl)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H10BrCl2N3O2/c15-8-3-1-2-7(6-8)11(13(18)21)20-14(22)12-9(16)4-5-10(17)19-12/h1-6,11H,(H2,18,21)(H,20,22) |
| InChIKey | ZEOKSAVUYKAXLC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.06 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|