C20H16Cl2N2O2 — CID 46523092
3,6-dichloro-N-[(4-methoxyphenyl)-phenylmethyl]pyridine-2-carboxamide (PubChem CID 46523092) has the molecular formula C20H16Cl2N2O2 and a molecular weight of 387.27 g/mol. Its IUPAC name is 3,6-dichloro-N-[(4-methoxyphenyl)-phenylmethyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(4-methoxyphenyl)-phenylmethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46523092 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3,6-dichloro-N-[(4-methoxyphenyl)-phenylmethyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(C(NC(=O)c2nc(Cl)ccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O2/c1-26-15-9-7-14(8-10-15)18(13-5-3-2-4-6-13)24-20(25)19-16(21)11-12-17(22)23-19/h2-12,18H,1H3,(H,24,25) |
| InChIKey | MGDKRCFJHOYBOL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|