C23H23NO4 — CID 9118748
2,5-dimethoxy-N-[(S)-(4-methoxyphenyl)-phenylmethyl]benzamide (PubChem CID 9118748) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[(S)-(4-methoxyphenyl)-phenylmethyl]benzamide.
| Compound Name | 2,5-dimethoxy-N-[(S)-(4-methoxyphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 9118748 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2,5-dimethoxy-N-[(S)-(4-methoxyphenyl)-phenylmethyl]benzamide |
| SMILES | COc1ccc([C@@H](NC(=O)c2cc(OC)ccc2OC)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-26-18-11-9-17(10-12-18)22(16-7-5-4-6-8-16)24-23(25)20-15-19(27-2)13-14-21(20)28-3/h4-15,22H,1-3H3,(H,24,25)/t22-/m0/s1 |
| InChIKey | SYIBKYWIXGVQPD-QFIPXVFZSA-N |
| XLogP | 4.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |