C13H15NO3 — CID 114389664
N-but-3-yn-2-yl-2,5-dimethoxybenzamide (PubChem CID 114389664) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,5-dimethoxybenzamide.
| Compound Name | N-but-3-yn-2-yl-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 114389664 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-but-3-yn-2-yl-2,5-dimethoxybenzamide |
| SMILES | C#CC(C)NC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H15NO3/c1-5-9(2)14-13(15)11-8-10(16-3)6-7-12(11)17-4/h1,6-9H,2-4H3,(H,14,15) |
| InChIKey | DACROFWOSTULCE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|