C21H14F5NO2 — CID 2190610
2,3,4,5,6-pentafluoro-N-[(R)-(4-methoxyphenyl)-phenylmethyl]benzamide (PubChem CID 2190610) has the molecular formula C21H14F5NO2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(R)-(4-methoxyphenyl)-phenylmethyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(R)-(4-methoxyphenyl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 2190610 |
| Molecular Formula | C21H14F5NO2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(R)-(4-methoxyphenyl)-phenylmethyl]benzamide |
| SMILES | COc1ccc([C@H](NC(=O)c2c(F)c(F)c(F)c(F)c2F)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14F5NO2/c1-29-13-9-7-12(8-10-13)20(11-5-3-2-4-6-11)27-21(28)14-15(22)17(24)19(26)18(25)16(14)23/h2-10,20H,1H3,(H,27,28)/t20-/m1/s1 |
| InChIKey | XJFOPETVCVSASX-HXUWFJFHSA-N |
| XLogP | 4.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|