C20H19NO4 — CID 51217853
N-[furan-2-yl(phenyl)methyl]-2,5-dimethoxybenzamide (PubChem CID 51217853) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[furan-2-yl(phenyl)methyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[furan-2-yl(phenyl)methyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 51217853 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[furan-2-yl(phenyl)methyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)NC(c2ccccc2)c2ccco2)c1 |
| InChI | InChI=1S/C20H19NO4/c1-23-15-10-11-17(24-2)16(13-15)20(22)21-19(18-9-6-12-25-18)14-7-4-3-5-8-14/h3-13,19H,1-2H3,(H,21,22) |
| InChIKey | KJRWKHDCDDWPGO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |