C25H22N2O5S — CID 134029296
N-[furan-2-yl(phenyl)methyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 134029296) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[furan-2-yl(phenyl)methyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[furan-2-yl(phenyl)methyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 134029296 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-[furan-2-yl(phenyl)methyl]-3-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NC(c3ccccc3)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C25H22N2O5S/c1-31-21-14-12-20(13-15-21)27-33(29,30)22-10-5-9-19(17-22)25(28)26-24(23-11-6-16-32-23)18-7-3-2-4-8-18/h2-17,24,27H,1H3,(H,26,28) |
| InChIKey | NKKGCMABGGHIRL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |