C22H19F3N2O4S — CID 55985947
3-[(4-methoxyphenyl)sulfamoyl]-N-(2,2,2-trifluoro-1-phenylethyl)benzamide (PubChem CID 55985947) has the molecular formula C22H19F3N2O4S and a molecular weight of 464.47 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfamoyl]-N-(2,2,2-trifluoro-1-phenylethyl)benzamide.
| Compound Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-(2,2,2-trifluoro-1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 55985947 |
| Molecular Formula | C22H19F3N2O4S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-(2,2,2-trifluoro-1-phenylethyl)benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NC(c3ccccc3)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H19F3N2O4S/c1-31-18-12-10-17(11-13-18)27-32(29,30)19-9-5-8-16(14-19)21(28)26-20(22(23,24)25)15-6-3-2-4-7-15/h2-14,20,27H,1H3,(H,26,28) |
| InChIKey | YDDUHBXXSMACST-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |