C15H11BrCl2N2O3 — CID 52537516
methyl (2S)-2-(4-bromophenyl)-2-[(3,6-dichloropyridine-2-carbonyl)amino]acetate (PubChem CID 52537516) has the molecular formula C15H11BrCl2N2O3 and a molecular weight of 418.07 g/mol. Its IUPAC name is methyl (2S)-2-(4-bromophenyl)-2-[(3,6-dichloropyridine-2-carbonyl)amino]acetate.
| Compound Name | methyl (2S)-2-(4-bromophenyl)-2-[(3,6-dichloropyridine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 52537516 |
| Molecular Formula | C15H11BrCl2N2O3 |
| Molecular Weight | 418.07 g/mol |
| Exact Mass | 415.93 |
| IUPAC Name | methyl (2S)-2-(4-bromophenyl)-2-[(3,6-dichloropyridine-2-carbonyl)amino]acetate |
| SMILES | COC(=O)[C@@H](NC(=O)c1nc(Cl)ccc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11BrCl2N2O3/c1-23-15(22)12(8-2-4-9(16)5-3-8)20-14(21)13-10(17)6-7-11(18)19-13/h2-7,12H,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | WSNMDAJMHFQURN-LBPRGKRZSA-N |
| XLogP | 3.80 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.07 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|